C12H13IN2O2 — CID 101043352
tert-butyl 3-iodopyrrolo[3,2-b]pyridine-1-carboxylate (PubChem CID 101043352) has the molecular formula C12H13IN2O2 and a molecular weight of 344.15 g/mol. Its IUPAC name is tert-butyl 3-iodopyrrolo[3,2-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-iodopyrrolo[3,2-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 101043352 |
| Molecular Formula | C12H13IN2O2 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | tert-butyl 3-iodopyrrolo[3,2-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(I)c2ncccc21 |
| InChI | InChI=1S/C12H13IN2O2/c1-12(2,3)17-11(16)15-7-8(13)10-9(15)5-4-6-14-10/h4-7H,1-3H3 |
| InChIKey | KDHRAEOQNBFTPX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|