C11H11ClIN3O2 — CID 57416864
tert-butyl 4-chloro-5-iodopyrrolo[2,3-d]pyrimidine-7-carboxylate (PubChem CID 57416864) has the molecular formula C11H11ClIN3O2 and a molecular weight of 379.59 g/mol. Its IUPAC name is tert-butyl 4-chloro-5-iodopyrrolo[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | tert-butyl 4-chloro-5-iodopyrrolo[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 57416864 |
| Molecular Formula | C11H11ClIN3O2 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | tert-butyl 4-chloro-5-iodopyrrolo[2,3-d]pyrimidine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(I)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C11H11ClIN3O2/c1-11(2,3)18-10(17)16-4-6(13)7-8(12)14-5-15-9(7)16/h4-5H,1-3H3 |
| InChIKey | AGIMUTXQXSASMW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|