C10H11ClN4O2 — CID 87694706
tert-butyl 4-chloropyrazolo[5,4-d]pyrimidine-1-carboxylate (PubChem CID 87694706) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is tert-butyl 4-chloropyrazolo[5,4-d]pyrimidine-1-carboxylate.
| Compound Name | tert-butyl 4-chloropyrazolo[5,4-d]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 87694706 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | tert-butyl 4-chloropyrazolo[5,4-d]pyrimidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2c(Cl)ncnc21 |
| InChI | InChI=1S/C10H11ClN4O2/c1-10(2,3)17-9(16)15-8-6(4-14-15)7(11)12-5-13-8/h4-5H,1-3H3 |
| InChIKey | FIHKHWDZZFQXDU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |