C11H11Cl2N3O2 — CID 125425796
tert-butyl 4,6-dichloropyrazolo[5,4-b]pyridine-1-carboxylate (PubChem CID 125425796) has the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is tert-butyl 4,6-dichloropyrazolo[5,4-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 4,6-dichloropyrazolo[5,4-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 125425796 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | tert-butyl 4,6-dichloropyrazolo[5,4-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2c(Cl)cc(Cl)nc21 |
| InChI | InChI=1S/C11H11Cl2N3O2/c1-11(2,3)18-10(17)16-9-6(5-14-16)7(12)4-8(13)15-9/h4-5H,1-3H3 |
| InChIKey | BRGIRZBUNBPDTP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|