C21H27Cl2N3O2 — CID 168977580
tert-butyl (2R,6S)-4-(2,4-dichloro-8-methylquinolin-6-yl)-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 168977580) has the molecular formula C21H27Cl2N3O2 and a molecular weight of 424.37 g/mol. Its IUPAC name is tert-butyl (2R,6S)-4-(2,4-dichloro-8-methylquinolin-6-yl)-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-4-(2,4-dichloro-8-methylquinolin-6-yl)-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168977580 |
| Molecular Formula | C21H27Cl2N3O2 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | tert-butyl (2R,6S)-4-(2,4-dichloro-8-methylquinolin-6-yl)-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | Cc1cc(N2C[C@@H](C)N(C(=O)OC(C)(C)C)[C@@H](C)C2)cc2c(Cl)cc(Cl)nc12 |
| InChI | InChI=1S/C21H27Cl2N3O2/c1-12-7-15(8-16-17(22)9-18(23)24-19(12)16)25-10-13(2)26(14(3)11-25)20(27)28-21(4,5)6/h7-9,13-14H,10-11H2,1-6H3/t13-,14+ |
| InChIKey | MWLOVAUUMUOLJC-OKILXGFUSA-N |
| XLogP | 5.68 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|