C17H27N3O3 — CID 156708851
tert-butyl 4-(4-amino-3-hydroxyphenyl)-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 156708851) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-3-hydroxyphenyl)-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-3-hydroxyphenyl)-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 156708851 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl 4-(4-amino-3-hydroxyphenyl)-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | CC1CN(c2ccc(N)c(O)c2)CC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-11-9-19(13-6-7-14(18)15(21)8-13)10-12(2)20(11)16(22)23-17(3,4)5/h6-8,11-12,21H,9-10,18H2,1-5H3 |
| InChIKey | LFOCZWPJHWKBGY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|