C16H23N3O5 — CID 139751877
tert-butyl N-[2-[(5S)-3-(4-amino-3-hydroxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]ethyl]carbamate (PubChem CID 139751877) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is tert-butyl N-[2-[(5S)-3-(4-amino-3-hydroxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5S)-3-(4-amino-3-hydroxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 139751877 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl N-[2-[(5S)-3-(4-amino-3-hydroxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@H]1CN(c2ccc(N)c(O)c2)C(=O)O1 |
| InChI | InChI=1S/C16H23N3O5/c1-16(2,3)24-14(21)18-7-6-11-9-19(15(22)23-11)10-4-5-12(17)13(20)8-10/h4-5,8,11,20H,6-7,9,17H2,1-3H3,(H,18,21)/t11-/m0/s1 |
| InChIKey | GVQCOSWMBBOLST-NSHDSACASA-N |
| XLogP | 2.21 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|