C18H24N4O5S — CID 173214204
tert-butyl N-[[3-(2-methoxyimino-3-methyl-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 173214204) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is tert-butyl N-[[3-(2-methoxyimino-3-methyl-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(2-methoxyimino-3-methyl-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 173214204 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | tert-butyl N-[[3-(2-methoxyimino-3-methyl-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | CON=c1sc2cc(N3CC(CNC(=O)OC(C)(C)C)OC3=O)ccc2n1C |
| InChI | InChI=1S/C18H24N4O5S/c1-18(2,3)27-16(23)19-9-12-10-22(17(24)26-12)11-6-7-13-14(8-11)28-15(20-25-5)21(13)4/h6-8,12H,9-10H2,1-5H3,(H,19,23) |
| InChIKey | LUBQIELOMPXQGK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|