C19H24N4O7S — CID 173214372
acetyl acetate;N-[[(5S)-3-(2-methoxyimino-3-methyl-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 173214372) has the molecular formula C19H24N4O7S and a molecular weight of 452.49 g/mol. Its IUPAC name is acetyl acetate;N-[[(5S)-3-(2-methoxyimino-3-methyl-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | acetyl acetate;N-[[(5S)-3-(2-methoxyimino-3-methyl-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 173214372 |
| Molecular Formula | C19H24N4O7S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | acetyl acetate;N-[[(5S)-3-(2-methoxyimino-3-methyl-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)OC(C)=O.CON=c1sc2cc(N3C[C@H](CNC(C)=O)OC3=O)ccc2n1C |
| InChI | InChI=1S/C15H18N4O4S.C4H6O3/c1-9(20)16-7-11-8-19(15(21)23-11)10-4-5-12-13(6-10)24-14(17-22-3)18(12)2;1-3(5)7-4(2)6/h4-6,11H,7-8H2,1-3H3,(H,16,20);1-2H3/t11-;/m0./s1 |
| InChIKey | BHSQKCYEASBZRH-MERQFXBCSA-N |
| XLogP | 1.26 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|