C19H26N4O5S — CID 173214393
tert-butyl N-[[3-(3-ethyl-2-methoxyimino-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 173214393) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is tert-butyl N-[[3-(3-ethyl-2-methoxyimino-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(3-ethyl-2-methoxyimino-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 173214393 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | tert-butyl N-[[3-(3-ethyl-2-methoxyimino-1,3-benzothiazol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | CCn1c(=NOC)sc2cc(N3CC(CNC(=O)OC(C)(C)C)OC3=O)ccc21 |
| InChI | InChI=1S/C19H26N4O5S/c1-6-22-14-8-7-12(9-15(14)29-16(22)21-26-5)23-11-13(27-18(23)25)10-20-17(24)28-19(2,3)4/h7-9,13H,6,10-11H2,1-5H3,(H,20,24) |
| InChIKey | ZAVKXMHBDAPENS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|