C13H15IN2O4 — CID 57270308
N-[[(5S)-3-(4-iodo-3-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 57270308) has the molecular formula C13H15IN2O4 and a molecular weight of 390.18 g/mol. Its IUPAC name is N-[[(5S)-3-(4-iodo-3-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-(4-iodo-3-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 57270308 |
| Molecular Formula | C13H15IN2O4 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | N-[[(5S)-3-(4-iodo-3-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | COc1cc(N2C[C@H](CNC(C)=O)OC2=O)ccc1I |
| InChI | InChI=1S/C13H15IN2O4/c1-8(17)15-6-10-7-16(13(18)20-10)9-3-4-11(14)12(5-9)19-2/h3-5,10H,6-7H2,1-2H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | DMUVMXOSTGSNKA-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|