C12H12FIN2O4 — CID 58610310
methyl N-[[(5S)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 58610310) has the molecular formula C12H12FIN2O4 and a molecular weight of 394.14 g/mol. Its IUPAC name is methyl N-[[(5S)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | methyl N-[[(5S)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58610310 |
| Molecular Formula | C12H12FIN2O4 |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | methyl N-[[(5S)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | COC(=O)NC[C@H]1CN(c2ccc(I)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C12H12FIN2O4/c1-19-11(17)15-5-8-6-16(12(18)20-8)7-2-3-10(14)9(13)4-7/h2-4,8H,5-6H2,1H3,(H,15,17)/t8-/m0/s1 |
| InChIKey | IDWDWXCUUURMJL-QMMMGPOBSA-N |
| XLogP | 2.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|