C12H11FINO4 — CID 139974744
[(5S)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl acetate (PubChem CID 139974744) has the molecular formula C12H11FINO4 and a molecular weight of 379.13 g/mol. Its IUPAC name is [(5S)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl acetate.
| Compound Name | [(5S)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl acetate |
|---|---|
| PubChem CID | 139974744 |
| Molecular Formula | C12H11FINO4 |
| Molecular Weight | 379.13 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | [(5S)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CN(c2ccc(I)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C12H11FINO4/c1-7(16)18-6-9-5-15(12(17)19-9)8-2-3-11(14)10(13)4-8/h2-4,9H,5-6H2,1H3/t9-/m0/s1 |
| InChIKey | TWUKYWKTFHLMFL-VIFPVBQESA-N |
| XLogP | 2.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.13 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|