C14H17ClFNO5 — CID 121351579
5-(chloromethyl)-3-(3-fluoro-4-hydroxyphenyl)-1,3-oxazolidin-2-one;ethyl acetate (PubChem CID 121351579) has the molecular formula C14H17ClFNO5 and a molecular weight of 333.74 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(3-fluoro-4-hydroxyphenyl)-1,3-oxazolidin-2-one;ethyl acetate.
| Compound Name | 5-(chloromethyl)-3-(3-fluoro-4-hydroxyphenyl)-1,3-oxazolidin-2-one;ethyl acetate |
|---|---|
| PubChem CID | 121351579 |
| Molecular Formula | C14H17ClFNO5 |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 5-(chloromethyl)-3-(3-fluoro-4-hydroxyphenyl)-1,3-oxazolidin-2-one;ethyl acetate |
| SMILES | CCOC(C)=O.O=C1OC(CCl)CN1c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C10H9ClFNO3.C4H8O2/c11-4-7-5-13(10(15)16-7)6-1-2-9(14)8(12)3-6;1-3-6-4(2)5/h1-3,7,14H,4-5H2;3H2,1-2H3 |
| InChIKey | WXBMMEGKRZTMGJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|