C16H20ClFN2O4 — CID 121356776
(5R)-5-(chloromethyl)-3-[3-fluoro-4-[(4-hydroxypiperidin-4-yl)methoxy]phenyl]-1,3-oxazolidin-2-one (PubChem CID 121356776) has the molecular formula C16H20ClFN2O4 and a molecular weight of 358.80 g/mol. Its IUPAC name is (5R)-5-(chloromethyl)-3-[3-fluoro-4-[(4-hydroxypiperidin-4-yl)methoxy]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(chloromethyl)-3-[3-fluoro-4-[(4-hydroxypiperidin-4-yl)methoxy]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 121356776 |
| Molecular Formula | C16H20ClFN2O4 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (5R)-5-(chloromethyl)-3-[3-fluoro-4-[(4-hydroxypiperidin-4-yl)methoxy]phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CCl)CN1c1ccc(OCC2(O)CCNCC2)c(F)c1 |
| InChI | InChI=1S/C16H20ClFN2O4/c17-8-12-9-20(15(21)24-12)11-1-2-14(13(18)7-11)23-10-16(22)3-5-19-6-4-16/h1-2,7,12,19,22H,3-6,8-10H2/t12-/m0/s1 |
| InChIKey | JZZYSSUREMYDIE-LBPRGKRZSA-N |
| XLogP | 1.88 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|