C10H10FINO6P — CID 141380839
[(5R)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate (PubChem CID 141380839) has the molecular formula C10H10FINO6P and a molecular weight of 417.07 g/mol. Its IUPAC name is [(5R)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate.
| Compound Name | [(5R)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 141380839 |
| Molecular Formula | C10H10FINO6P |
| Molecular Weight | 417.07 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | [(5R)-3-(3-fluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate |
| SMILES | O=C1O[C@@H](COP(=O)(O)O)CN1c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C10H10FINO6P/c11-8-3-6(1-2-9(8)12)13-4-7(19-10(13)14)5-18-20(15,16)17/h1-3,7H,4-5H2,(H2,15,16,17)/t7-/m1/s1 |
| InChIKey | ORRBGDVWXDAQNJ-SSDOTTSWSA-N |
| XLogP | 1.86 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.07 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|