C13H10FIN2O4 — CID 11859040
(5R)-3-(3-fluoro-4-iodophenyl)-5-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one (PubChem CID 11859040) has the molecular formula C13H10FIN2O4 and a molecular weight of 404.14 g/mol. Its IUPAC name is (5R)-3-(3-fluoro-4-iodophenyl)-5-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-(3-fluoro-4-iodophenyl)-5-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11859040 |
| Molecular Formula | C13H10FIN2O4 |
| Molecular Weight | 404.14 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | (5R)-3-(3-fluoro-4-iodophenyl)-5-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](COc2ccon2)CN1c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C13H10FIN2O4/c14-10-5-8(1-2-11(10)15)17-6-9(21-13(17)18)7-19-12-3-4-20-16-12/h1-5,9H,6-7H2/t9-/m1/s1 |
| InChIKey | RXFKLRWZERWUDW-SECBINFHSA-N |
| XLogP | 2.82 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.14 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|