C17H18FN3O5 — CID 22996047
3-(3-fluoro-4-morpholin-4-ylphenyl)-5-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one (PubChem CID 22996047) has the molecular formula C17H18FN3O5 and a molecular weight of 363.35 g/mol. Its IUPAC name is 3-(3-fluoro-4-morpholin-4-ylphenyl)-5-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-fluoro-4-morpholin-4-ylphenyl)-5-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22996047 |
| Molecular Formula | C17H18FN3O5 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-(3-fluoro-4-morpholin-4-ylphenyl)-5-(1,2-oxazol-3-yloxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(COc2ccon2)CN1c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C17H18FN3O5/c18-14-9-12(1-2-15(14)20-4-7-23-8-5-20)21-10-13(26-17(21)22)11-24-16-3-6-25-19-16/h1-3,6,9,13H,4-5,7-8,10-11H2 |
| InChIKey | FQNHEVCCOYGYJD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|