C17H19FN4O4 — CID 22014514
3-(3-fluoro-4-morpholin-4-ylphenyl)-5-[(1,2-oxazol-3-ylamino)methyl]-1,3-oxazolidin-2-one (PubChem CID 22014514) has the molecular formula C17H19FN4O4 and a molecular weight of 362.36 g/mol. Its IUPAC name is 3-(3-fluoro-4-morpholin-4-ylphenyl)-5-[(1,2-oxazol-3-ylamino)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-fluoro-4-morpholin-4-ylphenyl)-5-[(1,2-oxazol-3-ylamino)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22014514 |
| Molecular Formula | C17H19FN4O4 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-(3-fluoro-4-morpholin-4-ylphenyl)-5-[(1,2-oxazol-3-ylamino)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CNc2ccon2)CN1c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C17H19FN4O4/c18-14-9-12(1-2-15(14)21-4-7-24-8-5-21)22-11-13(26-17(22)23)10-19-16-3-6-25-20-16/h1-3,6,9,13H,4-5,7-8,10-11H2,(H,19,20) |
| InChIKey | TVPUMVJRZRSATF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|