C19H22FN5O4 — CID 22014500
N-[1-[2-fluoro-4-[5-[(1,2-oxazol-3-ylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]pyrrolidin-3-yl]acetamide (PubChem CID 22014500) has the molecular formula C19H22FN5O4 and a molecular weight of 403.41 g/mol. Its IUPAC name is N-[1-[2-fluoro-4-[5-[(1,2-oxazol-3-ylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-[2-fluoro-4-[5-[(1,2-oxazol-3-ylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 22014500 |
| Molecular Formula | C19H22FN5O4 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[1-[2-fluoro-4-[5-[(1,2-oxazol-3-ylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(c2ccc(N3CC(CNc4ccon4)OC3=O)cc2F)C1 |
| InChI | InChI=1S/C19H22FN5O4/c1-12(26)22-13-4-6-24(10-13)17-3-2-14(8-16(17)20)25-11-15(29-19(25)27)9-21-18-5-7-28-23-18/h2-3,5,7-8,13,15H,4,6,9-11H2,1H3,(H,21,23)(H,22,26) |
| InChIKey | YJVBHVUHDBLJNB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|