C24H25FN6O3 — CID 44600111
N-[[(5S)-3-[3-fluoro-4-[3-(4-pyridin-4-ylpyrazol-1-yl)pyrrolidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 44600111) has the molecular formula C24H25FN6O3 and a molecular weight of 464.50 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[3-(4-pyridin-4-ylpyrazol-1-yl)pyrrolidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[3-(4-pyridin-4-ylpyrazol-1-yl)pyrrolidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 44600111 |
| Molecular Formula | C24H25FN6O3 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[3-(4-pyridin-4-ylpyrazol-1-yl)pyrrolidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCC(n4cc(-c5ccncc5)cn4)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H25FN6O3/c1-16(32)27-12-21-15-30(24(33)34-21)19-2-3-23(22(25)10-19)29-9-6-20(14-29)31-13-18(11-28-31)17-4-7-26-8-5-17/h2-5,7-8,10-11,13,20-21H,6,9,12,14-15H2,1H3,(H,27,32)/t20?,21-/m0/s1 |
| InChIKey | CJNVFIKVBIZVFS-LBAQZLPGSA-N |
| XLogP | 3.00 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|