C19H21FN6O5 — CID 44599797
N-[[(5S)-3-[3-fluoro-4-[3-(4-nitropyrazol-1-yl)pyrrolidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 44599797) has the molecular formula C19H21FN6O5 and a molecular weight of 432.41 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[3-(4-nitropyrazol-1-yl)pyrrolidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[3-(4-nitropyrazol-1-yl)pyrrolidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 44599797 |
| Molecular Formula | C19H21FN6O5 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[3-(4-nitropyrazol-1-yl)pyrrolidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCC(n4cc([N+](=O)[O-])cn4)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H21FN6O5/c1-12(27)21-8-16-11-24(19(28)31-16)13-2-3-18(17(20)6-13)23-5-4-14(9-23)25-10-15(7-22-25)26(29)30/h2-3,6-7,10,14,16H,4-5,8-9,11H2,1H3,(H,21,27)/t14?,16-/m0/s1 |
| InChIKey | DDAGDOKPDXJLNQ-WMCAAGNKSA-N |
| XLogP | 1.84 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|