C20H22FN7O5 — CID 57275013
N-[[(5S)-3-[3-fluoro-4-[4-(5-nitropyrimidin-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 57275013) has the molecular formula C20H22FN7O5 and a molecular weight of 459.44 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(5-nitropyrimidin-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(5-nitropyrimidin-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 57275013 |
| Molecular Formula | C20H22FN7O5 |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(5-nitropyrimidin-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(c4ncc([N+](=O)[O-])cn4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H22FN7O5/c1-13(29)22-11-16-12-27(20(30)33-16)14-2-3-18(17(21)8-14)25-4-6-26(7-5-25)19-23-9-15(10-24-19)28(31)32/h2-3,8-10,16H,4-7,11-12H2,1H3,(H,22,29)/t16-/m0/s1 |
| InChIKey | MBDJUWGYFWYABM-INIZCTEOSA-N |
| XLogP | 1.31 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|