C21H22FN5O6S — CID 10230087
N-[[(5S)-3-[3-fluoro-4-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10230087) has the molecular formula C21H22FN5O6S and a molecular weight of 491.50 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10230087 |
| Molecular Formula | C21H22FN5O6S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(5-nitrothiophene-2-carbonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)c4ccc([N+](=O)[O-])s4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H22FN5O6S/c1-13(28)23-11-15-12-26(21(30)33-15)14-2-3-17(16(22)10-14)24-6-8-25(9-7-24)20(29)18-4-5-19(34-18)27(31)32/h2-5,10,15H,6-9,11-12H2,1H3,(H,23,28)/t15-/m0/s1 |
| InChIKey | FRTWEPAXMSVMIK-HNNXBMFYSA-N |
| XLogP | 2.22 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|