C22H23FN4O5S3 — CID 10007428
N-[[(5S)-3-[3-fluoro-4-[1-(5-nitrothiophene-2-carbothioyl)piperidin-4-yl]oxyphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 10007428) has the molecular formula C22H23FN4O5S3 and a molecular weight of 538.65 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[1-(5-nitrothiophene-2-carbothioyl)piperidin-4-yl]oxyphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[1-(5-nitrothiophene-2-carbothioyl)piperidin-4-yl]oxyphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 10007428 |
| Molecular Formula | C22H23FN4O5S3 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[1-(5-nitrothiophene-2-carbothioyl)piperidin-4-yl]oxyphenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(OC3CCN(C(=S)c4ccc([N+](=O)[O-])s4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H23FN4O5S3/c1-13(33)24-11-16-12-26(22(28)32-16)14-2-3-18(17(23)10-14)31-15-6-8-25(9-7-15)21(34)19-4-5-20(35-19)27(29)30/h2-5,10,15-16H,6-9,11-12H2,1H3,(H,24,33)/t16-/m0/s1 |
| InChIKey | CDZNZZCNWHPXHQ-INIZCTEOSA-N |
| XLogP | 4.28 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|