C18H20FN5O4S2 — CID 72787373
1-[[3-[3-fluoro-4-[methyl-[(5-nitrothiophen-2-yl)methyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea (PubChem CID 72787373) has the molecular formula C18H20FN5O4S2 and a molecular weight of 453.52 g/mol. Its IUPAC name is 1-[[3-[3-fluoro-4-[methyl-[(5-nitrothiophen-2-yl)methyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea.
| Compound Name | 1-[[3-[3-fluoro-4-[methyl-[(5-nitrothiophen-2-yl)methyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea |
|---|---|
| PubChem CID | 72787373 |
| Molecular Formula | C18H20FN5O4S2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 1-[[3-[3-fluoro-4-[methyl-[(5-nitrothiophen-2-yl)methyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea |
| SMILES | CNC(=S)NCC1CN(c2ccc(N(C)Cc3ccc([N+](=O)[O-])s3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H20FN5O4S2/c1-20-17(29)21-8-12-9-23(18(25)28-12)11-3-5-15(14(19)7-11)22(2)10-13-4-6-16(30-13)24(26)27/h3-7,12H,8-10H2,1-2H3,(H2,20,21,29) |
| InChIKey | MZDDJBUGQIUNJT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|