C15H13FN4O4S3 — CID 22966270
N-[[3-[3-fluoro-4-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 22966270) has the molecular formula C15H13FN4O4S3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[3-[3-fluoro-4-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 22966270 |
| Molecular Formula | C15H13FN4O4S3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | N-[[3-[3-fluoro-4-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCC1CN(c2ccc(Sc3ncc([N+](=O)[O-])s3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H13FN4O4S3/c1-8(25)17-5-10-7-19(15(21)24-10)9-2-3-12(11(16)4-9)26-14-18-6-13(27-14)20(22)23/h2-4,6,10H,5,7H2,1H3,(H,17,25) |
| InChIKey | JSJATIDRALDSGN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|