C25H21FN4O5S — CID 143554905
N-[[(5S)-3-[3-fluoro-4-[[4-(4-nitrophenyl)-7-oxocyclohepta-1,3,5-trien-1-yl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 143554905) has the molecular formula C25H21FN4O5S and a molecular weight of 508.53 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[[4-(4-nitrophenyl)-7-oxocyclohepta-1,3,5-trien-1-yl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[[4-(4-nitrophenyl)-7-oxocyclohepta-1,3,5-trien-1-yl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 143554905 |
| Molecular Formula | C25H21FN4O5S |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[[4-(4-nitrophenyl)-7-oxocyclohepta-1,3,5-trien-1-yl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(Nc3ccc(-c4ccc([N+](=O)[O-])cc4)ccc3=O)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H21FN4O5S/c1-15(36)27-13-20-14-29(25(32)35-20)19-8-10-22(21(26)12-19)28-23-9-4-17(5-11-24(23)31)16-2-6-18(7-3-16)30(33)34/h2-12,20H,13-14H2,1H3,(H,27,36)(H,28,31)/t20-/m0/s1 |
| InChIKey | SYTLTLZMJUDYQI-FQEVSTJZSA-N |
| XLogP | 4.77 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|