C21H22FN5O6 — CID 73355575
1-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-(4-nitrophenyl)urea (PubChem CID 73355575) has the molecular formula C21H22FN5O6 and a molecular weight of 459.43 g/mol. Its IUPAC name is 1-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 73355575 |
| Molecular Formula | C21H22FN5O6 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(NC[C@H]1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H22FN5O6/c22-18-11-16(5-6-19(18)25-7-9-32-10-8-25)26-13-17(33-21(26)29)12-23-20(28)24-14-1-3-15(4-2-14)27(30)31/h1-6,11,17H,7-10,12-13H2,(H2,23,24,28)/t17-/m0/s1 |
| InChIKey | GPRHYESQEONDRT-KRWDZBQOSA-N |
| XLogP | 2.72 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|