C24H25FN6O4S — CID 87543198
N-[[3-[4-[4-cyano-4-(3-nitroanilino)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 87543198) has the molecular formula C24H25FN6O4S and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[[3-[4-[4-cyano-4-(3-nitroanilino)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[3-[4-[4-cyano-4-(3-nitroanilino)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 87543198 |
| Molecular Formula | C24H25FN6O4S |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | N-[[3-[4-[4-cyano-4-(3-nitroanilino)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCC1CN(c2ccc(N3CCC(C#N)(Nc4cccc([N+](=O)[O-])c4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H25FN6O4S/c1-16(36)27-13-20-14-30(23(32)35-20)18-5-6-22(21(25)12-18)29-9-7-24(15-26,8-10-29)28-17-3-2-4-19(11-17)31(33)34/h2-6,11-12,20,28H,7-10,13-14H2,1H3,(H,27,36) |
| InChIKey | SLTKEJOMOHGOKR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|