C19H24FN7O3S2 — CID 87542411
N-[[3-[4-[4-(2-carbamothioylhydrazinyl)-4-cyanopiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide (PubChem CID 87542411) has the molecular formula C19H24FN7O3S2 and a molecular weight of 481.58 g/mol. Its IUPAC name is N-[[3-[4-[4-(2-carbamothioylhydrazinyl)-4-cyanopiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide.
| Compound Name | N-[[3-[4-[4-(2-carbamothioylhydrazinyl)-4-cyanopiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 87542411 |
| Molecular Formula | C19H24FN7O3S2 |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[[3-[4-[4-(2-carbamothioylhydrazinyl)-4-cyanopiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide |
| SMILES | N#CC1(NNC(N)=S)CCN(c2ccc(N3CC(CNC(=O)CS)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H24FN7O3S2/c20-14-7-12(27-9-13(30-18(27)29)8-23-16(28)10-31)1-2-15(14)26-5-3-19(11-21,4-6-26)25-24-17(22)32/h1-2,7,13,25,31H,3-6,8-10H2,(H,23,28)(H3,22,24,32) |
| InChIKey | ZEAOXAUUQUAZAQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|