C19H23FN4O3S — CID 87780130
N-[[3-[4-[4-(cyanomethyl)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide (PubChem CID 87780130) has the molecular formula C19H23FN4O3S and a molecular weight of 406.48 g/mol. Its IUPAC name is N-[[3-[4-[4-(cyanomethyl)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide.
| Compound Name | N-[[3-[4-[4-(cyanomethyl)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 87780130 |
| Molecular Formula | C19H23FN4O3S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[[3-[4-[4-(cyanomethyl)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylacetamide |
| SMILES | N#CCC1CCN(c2ccc(N3CC(CNC(=O)CS)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H23FN4O3S/c20-16-9-14(24-11-15(27-19(24)26)10-22-18(25)12-28)1-2-17(16)23-7-4-13(3-6-21)5-8-23/h1-2,9,13,15,28H,3-5,7-8,10-12H2,(H,22,25) |
| InChIKey | QWFQHYVLUJYLCS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|