C19H20BrFN4O3 — CID 69312135
2-bromo-N-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 69312135) has the molecular formula C19H20BrFN4O3 and a molecular weight of 451.30 g/mol. Its IUPAC name is 2-bromo-N-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2-bromo-N-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 69312135 |
| Molecular Formula | C19H20BrFN4O3 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 2-bromo-N-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | N#CC=C1CCN(c2ccc(N3CC(CNC(=O)CBr)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H20BrFN4O3/c20-10-18(26)23-11-15-12-25(19(27)28-15)14-1-2-17(16(21)9-14)24-7-4-13(3-6-22)5-8-24/h1-3,9,15H,4-5,7-8,10-12H2,(H,23,26) |
| InChIKey | VDNAYBLDASKVRW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|