C19H20FIN4O3 — CID 59754186
N-[[(5S)-3-[3-fluoro-4-[4-(isocyanomethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-iodoacetamide (PubChem CID 59754186) has the molecular formula C19H20FIN4O3 and a molecular weight of 498.30 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(isocyanomethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-iodoacetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(isocyanomethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-iodoacetamide |
|---|---|
| PubChem CID | 59754186 |
| Molecular Formula | C19H20FIN4O3 |
| Molecular Weight | 498.30 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(isocyanomethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-iodoacetamide |
| SMILES | [C-]#[N+]C=C1CCN(c2ccc(N3C[C@H](CNC(=O)CI)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H20FIN4O3/c1-22-10-13-4-6-24(7-5-13)17-3-2-14(8-16(17)20)25-12-15(28-19(25)27)11-23-18(26)9-21/h2-3,8,10,15H,4-7,9,11-12H2,(H,23,26)/t15-/m0/s1 |
| InChIKey | TVCSDQJBCGZBJD-HNNXBMFYSA-N |
| XLogP | 3.11 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|