C20H24FN5O3 — CID 59754063
2-amino-N-[[(5S)-3-[3-fluoro-4-[4-(1-isocyanoethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 59754063) has the molecular formula C20H24FN5O3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 2-amino-N-[[(5S)-3-[3-fluoro-4-[4-(1-isocyanoethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2-amino-N-[[(5S)-3-[3-fluoro-4-[4-(1-isocyanoethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 59754063 |
| Molecular Formula | C20H24FN5O3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-amino-N-[[(5S)-3-[3-fluoro-4-[4-(1-isocyanoethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [C-]#[N+]C(C)=C1CCN(c2ccc(N3C[C@H](CNC(=O)CN)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H24FN5O3/c1-13(23-2)14-5-7-25(8-6-14)18-4-3-15(9-17(18)21)26-12-16(29-20(26)28)11-24-19(27)10-22/h3-4,9,16H,5-8,10-12,22H2,1H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | CMZHKKZBHBLHKC-INIZCTEOSA-N |
| XLogP | 2.02 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|