C20H20F4N4O3 — CID 90952029
2,2,2-trifluoro-N-[[(5S)-3-[3-fluoro-4-[4-(isocyanomethylidene)-3-methylpiperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 90952029) has the molecular formula C20H20F4N4O3 and a molecular weight of 440.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(5S)-3-[3-fluoro-4-[4-(isocyanomethylidene)-3-methylpiperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[(5S)-3-[3-fluoro-4-[4-(isocyanomethylidene)-3-methylpiperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 90952029 |
| Molecular Formula | C20H20F4N4O3 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(5S)-3-[3-fluoro-4-[4-(isocyanomethylidene)-3-methylpiperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [C-]#[N+]C=C1CCN(c2ccc(N3C[C@H](CNC(=O)C(F)(F)F)OC3=O)cc2F)CC1C |
| InChI | InChI=1S/C20H20F4N4O3/c1-12-10-27(6-5-13(12)8-25-2)17-4-3-14(7-16(17)21)28-11-15(31-19(28)30)9-26-18(29)20(22,23)24/h3-4,7-8,12,15H,5-6,9-11H2,1H3,(H,26,29)/t12?,15-/m0/s1 |
| InChIKey | ISMGIRYZNJAWBO-CVRLYYSRSA-N |
| XLogP | 3.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|