C20H20F4N4O3 — CID 89259798
N-[[(5S)-3-[4-[(4Z)-4-(cyanomethylidene)-3-methylpiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 89259798) has the molecular formula C20H20F4N4O3 and a molecular weight of 440.40 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[(4Z)-4-(cyanomethylidene)-3-methylpiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[(5S)-3-[4-[(4Z)-4-(cyanomethylidene)-3-methylpiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 89259798 |
| Molecular Formula | C20H20F4N4O3 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[[(5S)-3-[4-[(4Z)-4-(cyanomethylidene)-3-methylpiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1CN(c2ccc(N3C[C@H](CNC(=O)C(F)(F)F)OC3=O)cc2F)CC/C1=C/C#N |
| InChI | InChI=1S/C20H20F4N4O3/c1-12-10-27(7-5-13(12)4-6-25)17-3-2-14(8-16(17)21)28-11-15(31-19(28)30)9-26-18(29)20(22,23)24/h2-4,8,12,15H,5,7,9-11H2,1H3,(H,26,29)/b13-4-/t12?,15-/m0/s1 |
| InChIKey | NZEIGNZFLAWZOQ-FRUAZUBOSA-N |
| XLogP | 3.13 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|