C21H23FN4O5 — CID 173227129
N-[[(5S)-3-[4-[2-(cyanomethylidene)pyrrolidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;3-methyloxiran-2-one (PubChem CID 173227129) has the molecular formula C21H23FN4O5 and a molecular weight of 430.44 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[2-(cyanomethylidene)pyrrolidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;3-methyloxiran-2-one.
| Compound Name | N-[[(5S)-3-[4-[2-(cyanomethylidene)pyrrolidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;3-methyloxiran-2-one |
|---|---|
| PubChem CID | 173227129 |
| Molecular Formula | C21H23FN4O5 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[[(5S)-3-[4-[2-(cyanomethylidene)pyrrolidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;3-methyloxiran-2-one |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCCC3=CC#N)c(F)c2)C(=O)O1.CC1OC1=O |
| InChI | InChI=1S/C18H19FN4O3.C3H4O2/c1-12(24)21-10-15-11-23(18(25)26-15)14-4-5-17(16(19)9-14)22-8-2-3-13(22)6-7-20;1-2-3(4)5-2/h4-6,9,15H,2-3,8,10-11H2,1H3,(H,21,24);2H,1H3/t15-;/m0./s1 |
| InChIKey | GKIHAHWONACTNO-RSAXXLAASA-N |
| XLogP | 2.23 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|