C19H22FN5O2S — CID 87781239
2-amino-N-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 87781239) has the molecular formula C19H22FN5O2S and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-amino-N-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | 2-amino-N-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 87781239 |
| Molecular Formula | C19H22FN5O2S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-amino-N-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | N#CC=C1CCN(c2ccc(N3CC(CNC(=S)CN)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H22FN5O2S/c20-16-9-14(25-12-15(27-19(25)26)11-23-18(28)10-22)1-2-17(16)24-7-4-13(3-6-21)5-8-24/h1-3,9,15H,4-5,7-8,10-12,22H2,(H,23,28) |
| InChIKey | FTAOSSAISQGPSG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|