C19H20FN5O2 — CID 87779633
2-[[(5S)-3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylamino]acetonitrile (PubChem CID 87779633) has the molecular formula C19H20FN5O2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[[(5S)-3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylamino]acetonitrile.
| Compound Name | 2-[[(5S)-3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylamino]acetonitrile |
|---|---|
| PubChem CID | 87779633 |
| Molecular Formula | C19H20FN5O2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[[(5S)-3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylamino]acetonitrile |
| SMILES | CN(CC#N)[C@@H]1CN(c2ccc(N3CCC(=CC#N)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H20FN5O2/c1-23(11-8-22)18-13-25(19(26)27-18)15-2-3-17(16(20)12-15)24-9-5-14(4-7-21)6-10-24/h2-4,12,18H,5-6,9-11,13H2,1H3/t18-/m0/s1 |
| InChIKey | FIKVISYOBYWXMR-SFHVURJKSA-N |
| XLogP | 2.61 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|