C22H29FN6O2S — CID 87779717
1-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-1-[2-(dimethylamino)ethyl]thiourea (PubChem CID 87779717) has the molecular formula C22H29FN6O2S and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-1-[2-(dimethylamino)ethyl]thiourea.
| Compound Name | 1-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-1-[2-(dimethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 87779717 |
| Molecular Formula | C22H29FN6O2S |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 1-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-1-[2-(dimethylamino)ethyl]thiourea |
| SMILES | CN(C)CCN(CC1CN(c2ccc(N3CCC(=CC#N)CC3)c(F)c2)C(=O)O1)C(N)=S |
| InChI | InChI=1S/C22H29FN6O2S/c1-26(2)11-12-28(21(25)32)14-18-15-29(22(30)31-18)17-3-4-20(19(23)13-17)27-9-6-16(5-8-24)7-10-27/h3-5,13,18H,6-7,9-12,14-15H2,1-2H3,(H2,25,32) |
| InChIKey | ZPLJABYJJUVCMZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|