C21H25FN4O3S — CID 24886807
1-[[(2S)-4-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-5-oxooxolan-2-yl]methyl]-1-(2-hydroxyethyl)thiourea (PubChem CID 24886807) has the molecular formula C21H25FN4O3S and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[[(2S)-4-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-5-oxooxolan-2-yl]methyl]-1-(2-hydroxyethyl)thiourea.
| Compound Name | 1-[[(2S)-4-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-5-oxooxolan-2-yl]methyl]-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 24886807 |
| Molecular Formula | C21H25FN4O3S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-[[(2S)-4-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-5-oxooxolan-2-yl]methyl]-1-(2-hydroxyethyl)thiourea |
| SMILES | N#CC=C1CCN(c2ccc(C3C[C@@H](CN(CCO)C(N)=S)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C21H25FN4O3S/c22-18-11-15(1-2-19(18)25-7-4-14(3-6-23)5-8-25)17-12-16(29-20(17)28)13-26(9-10-27)21(24)30/h1-3,11,16-17,27H,4-5,7-10,12-13H2,(H2,24,30)/t16-,17?/m0/s1 |
| InChIKey | JXLGFPPBIKYNBB-BHWOMJMDSA-N |
| XLogP | 1.81 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|