C15H18FNO3S — CID 67654569
3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-(hydroxymethyl)oxolan-2-one (PubChem CID 67654569) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-(hydroxymethyl)oxolan-2-one.
| Compound Name | 3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 67654569 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-(hydroxymethyl)oxolan-2-one |
| SMILES | O=C1OC(CO)CC1c1ccc(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C15H18FNO3S/c16-13-7-10(12-8-11(9-18)20-15(12)19)1-2-14(13)17-3-5-21-6-4-17/h1-2,7,11-12,18H,3-6,8-9H2 |
| InChIKey | YFFYERQNPBRKFF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |