C20H23FN4O2 — CID 69315927
2-[1-[2-fluoro-4-[2-oxo-5-[(prop-2-enylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperidin-4-ylidene]acetonitrile (PubChem CID 69315927) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[1-[2-fluoro-4-[2-oxo-5-[(prop-2-enylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperidin-4-ylidene]acetonitrile.
| Compound Name | 2-[1-[2-fluoro-4-[2-oxo-5-[(prop-2-enylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperidin-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 69315927 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[1-[2-fluoro-4-[2-oxo-5-[(prop-2-enylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperidin-4-ylidene]acetonitrile |
| SMILES | C=CCNCC1CN(c2ccc(N3CCC(=CC#N)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H23FN4O2/c1-2-9-23-13-17-14-25(20(26)27-17)16-3-4-19(18(21)12-16)24-10-6-15(5-8-22)7-11-24/h2-5,12,17,23H,1,6-7,9-11,13-14H2 |
| InChIKey | DNVQXYYLDIBJHU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|