C20H20FN7O3 — CID 87781129
N-[1-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazol-4-yl]formamide (PubChem CID 87781129) has the molecular formula C20H20FN7O3 and a molecular weight of 425.42 g/mol. Its IUPAC name is N-[1-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazol-4-yl]formamide.
| Compound Name | N-[1-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazol-4-yl]formamide |
|---|---|
| PubChem CID | 87781129 |
| Molecular Formula | C20H20FN7O3 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[1-[[3-[4-[4-(cyanomethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazol-4-yl]formamide |
| SMILES | N#CC=C1CCN(c2ccc(N3CC(Cn4cc(NC=O)nn4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H20FN7O3/c21-17-9-15(1-2-18(17)26-7-4-14(3-6-22)5-8-26)28-11-16(31-20(28)30)10-27-12-19(23-13-29)24-25-27/h1-3,9,12-13,16H,4-5,7-8,10-11H2,(H,23,29) |
| InChIKey | DQGZJVHEQOALPE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|