C20H18FN7O2 — CID 59754052
1-[[(5R)-3-[3-fluoro-4-[4-(isocyanomethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4-carbonitrile (PubChem CID 59754052) has the molecular formula C20H18FN7O2 and a molecular weight of 407.41 g/mol. Its IUPAC name is 1-[[(5R)-3-[3-fluoro-4-[4-(isocyanomethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4-carbonitrile.
| Compound Name | 1-[[(5R)-3-[3-fluoro-4-[4-(isocyanomethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4-carbonitrile |
|---|---|
| PubChem CID | 59754052 |
| Molecular Formula | C20H18FN7O2 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-[[(5R)-3-[3-fluoro-4-[4-(isocyanomethylidene)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4-carbonitrile |
| SMILES | [C-]#[N+]C=C1CCN(c2ccc(N3C[C@H](Cn4cc(C#N)nn4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H18FN7O2/c1-23-10-14-4-6-26(7-5-14)19-3-2-16(8-18(19)21)28-13-17(30-20(28)29)12-27-11-15(9-22)24-25-27/h2-3,8,10-11,17H,4-7,12-13H2/t17-/m0/s1 |
| InChIKey | ZJDPMEMYNIRDAQ-KRWDZBQOSA-N |
| XLogP | 2.72 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|