C20H23FN6O5 — CID 87542207
N-[1-[[(5S)-3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazol-4-yl]formamide (PubChem CID 87542207) has the molecular formula C20H23FN6O5 and a molecular weight of 446.44 g/mol. Its IUPAC name is N-[1-[[(5S)-3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazol-4-yl]formamide.
| Compound Name | N-[1-[[(5S)-3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazol-4-yl]formamide |
|---|---|
| PubChem CID | 87542207 |
| Molecular Formula | C20H23FN6O5 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[1-[[(5S)-3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazol-4-yl]formamide |
| SMILES | O=CNc1cn(C[C@@H]2CN(c3ccc(N4CCC5(CC4)OCCO5)c(F)c3)C(=O)O2)nn1 |
| InChI | InChI=1S/C20H23FN6O5/c21-16-9-14(1-2-17(16)25-5-3-20(4-6-25)30-7-8-31-20)27-11-15(32-19(27)29)10-26-12-18(22-13-28)23-24-26/h1-2,9,12-13,15H,3-8,10-11H2,(H,22,28)/t15-/m1/s1 |
| InChIKey | JOGZQMXWZKASBB-OAHLLOKOSA-N |
| XLogP | 1.35 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|