C17H18FN5O2S — CID 135148294
3-[3-fluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-(triazol-2-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 135148294) has the molecular formula C17H18FN5O2S and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-[3-fluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-(triazol-2-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-fluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-(triazol-2-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135148294 |
| Molecular Formula | C17H18FN5O2S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 3-[3-fluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-(triazol-2-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(Cn2nccn2)CN1c1ccc(N2CC3(CSC3)C2)c(F)c1 |
| InChI | InChI=1S/C17H18FN5O2S/c18-14-5-12(1-2-15(14)21-8-17(9-21)10-26-11-17)22-6-13(25-16(22)24)7-23-19-3-4-20-23/h1-5,13H,6-11H2 |
| InChIKey | SYBMDXFMVFLMHD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|