C17H20FN5O2S — CID 126484479
(5R)-3-[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]-5-(triazol-2-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 126484479) has the molecular formula C17H20FN5O2S and a molecular weight of 377.45 g/mol. Its IUPAC name is (5R)-3-[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]-5-(triazol-2-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]-5-(triazol-2-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 126484479 |
| Molecular Formula | C17H20FN5O2S |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (5R)-3-[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]-5-(triazol-2-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](Cn2nccn2)CN1c1ccc(N2CCCSCC2)c(F)c1 |
| InChI | InChI=1S/C17H20FN5O2S/c18-15-10-13(2-3-16(15)21-6-1-8-26-9-7-21)22-11-14(25-17(22)24)12-23-19-4-5-20-23/h2-5,10,14H,1,6-9,11-12H2/t14-/m1/s1 |
| InChIKey | GNCFLAGJYBQXFS-CQSZACIVSA-N |
| XLogP | 2.39 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|