C22H25FN2O4S — CID 146924180
(5S)-3-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-[3-(furan-2-yl)-3-oxopropyl]-1,3-oxazolidin-2-one (PubChem CID 146924180) has the molecular formula C22H25FN2O4S and a molecular weight of 432.52 g/mol. Its IUPAC name is (5S)-3-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-[3-(furan-2-yl)-3-oxopropyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-[3-(furan-2-yl)-3-oxopropyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 146924180 |
| Molecular Formula | C22H25FN2O4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (5S)-3-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-[3-(furan-2-yl)-3-oxopropyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CC[C@H]1CN(c2ccc(N3CCCSCCC3)c(F)c2)C(=O)O1)c1ccco1 |
| InChI | InChI=1S/C22H25FN2O4S/c23-18-14-16(5-7-19(18)24-9-2-12-30-13-3-10-24)25-15-17(29-22(25)27)6-8-20(26)21-4-1-11-28-21/h1,4-5,7,11,14,17H,2-3,6,8-10,12-13,15H2/t17-/m0/s1 |
| InChIKey | ADTLYRKGYNUOEW-KRWDZBQOSA-N |
| XLogP | 4.74 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|